C18H23NO2S — CID 15808336
1-(3,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)ethanamine (PubChem CID 15808336) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)ethanamine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 15808336 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(2-phenylsulfanylethyl)ethanamine |
| SMILES | COc1ccc(C(C)NCCSc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H23NO2S/c1-14(15-9-10-17(20-2)18(13-15)21-3)19-11-12-22-16-7-5-4-6-8-16/h4-10,13-14,19H,11-12H2,1-3H3 |
| InChIKey | HIPBJAWWPUTHNW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|