C19H26N2O3 — CID 11587966
N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(3-methoxyphenyl)ethane-1,2-diamine (PubChem CID 11587966) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(3-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(3-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 11587966 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N'-[1-(3,4-dimethoxyphenyl)ethyl]-N-(3-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cccc(NCCNC(C)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-14(15-8-9-18(23-3)19(12-15)24-4)20-10-11-21-16-6-5-7-17(13-16)22-2/h5-9,12-14,20-21H,10-11H2,1-4H3 |
| InChIKey | TZKXJKMIMBWEBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|