C16H18FNO2 — CID 43194273
N-[1-(3,4-dimethoxyphenyl)ethyl]-3-fluoroaniline (PubChem CID 43194273) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-3-fluoroaniline.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 43194273 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3-fluoroaniline |
| SMILES | COc1ccc(C(C)Nc2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C16H18FNO2/c1-11(18-14-6-4-5-13(17)10-14)12-7-8-15(19-2)16(9-12)20-3/h4-11,18H,1-3H3 |
| InChIKey | JEIQMJJMVMDHHS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |