C18H23NO4 — CID 46021712
N-[1-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxyaniline (PubChem CID 46021712) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxyaniline.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 46021712 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NC(C)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C18H23NO4/c1-12(13-6-8-15(20-2)17(10-13)22-4)19-14-7-9-16(21-3)18(11-14)23-5/h6-12,19H,1-5H3 |
| InChIKey | VRKWTSFBBKKZDE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|