C15H14F3NO — CID 114838632
N-[1-(3,4-difluorophenyl)ethyl]-4-fluoro-3-methoxyaniline (PubChem CID 114838632) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-4-fluoro-3-methoxyaniline.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-4-fluoro-3-methoxyaniline |
|---|---|
| PubChem CID | 114838632 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-4-fluoro-3-methoxyaniline |
| SMILES | COc1cc(NC(C)c2ccc(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C15H14F3NO/c1-9(10-3-5-12(16)14(18)7-10)19-11-4-6-13(17)15(8-11)20-2/h3-9,19H,1-2H3 |
| InChIKey | DRAFREAXAWSBNJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |