C16H19N3O3 — CID 133270581
4-[1-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide (PubChem CID 133270581) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-[1-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide.
| Compound Name | 4-[1-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 133270581 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-[1-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(C(C)Nc2ccnc(C(N)=O)c2)cc1OC |
| InChI | InChI=1S/C16H19N3O3/c1-10(11-4-5-14(21-2)15(8-11)22-3)19-12-6-7-18-13(9-12)16(17)20/h4-10H,1-3H3,(H2,17,20)(H,18,19) |
| InChIKey | ZEWWXASKFSVOQK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |