C20H25NO6 — CID 92685210
2-(3,5-dimethoxyphenoxy)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 92685210) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenoxy)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethoxyphenoxy)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 92685210 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-(3,5-dimethoxyphenoxy)-N-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(OC)cc(OCC(=O)N[C@@H](C)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H25NO6/c1-13(14-6-7-18(25-4)19(8-14)26-5)21-20(22)12-27-17-10-15(23-2)9-16(11-17)24-3/h6-11,13H,12H2,1-5H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | PIXHAEQLWYNULN-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |