C18H19Cl2NO4 — CID 94050777
2-(2,4-dichlorophenoxy)-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 94050777) has the molecular formula C18H19Cl2NO4 and a molecular weight of 384.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 94050777 |
| Molecular Formula | C18H19Cl2NO4 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(1R)-1-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)COc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C18H19Cl2NO4/c1-11(12-4-6-16(23-2)17(8-12)24-3)21-18(22)10-25-15-7-5-13(19)9-14(15)20/h4-9,11H,10H2,1-3H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | NIYBMJNEIKABDR-LLVKDONJSA-N |
| XLogP | 4.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |