C15H17FN2O2 — CID 115591099
N-[1-(3,4-dimethoxyphenyl)ethyl]-6-fluoropyridin-2-amine (PubChem CID 115591099) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-6-fluoropyridin-2-amine.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 115591099 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-6-fluoropyridin-2-amine |
| SMILES | COc1ccc(C(C)Nc2cccc(F)n2)cc1OC |
| InChI | InChI=1S/C15H17FN2O2/c1-10(17-15-6-4-5-14(16)18-15)11-7-8-12(19-2)13(9-11)20-3/h4-10H,1-3H3,(H,17,18) |
| InChIKey | FJYLXSBPVRUBDM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|