C15H15FN2O — CID 115598197
N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-6-fluoropyridin-2-amine (PubChem CID 115598197) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-6-fluoropyridin-2-amine.
| Compound Name | N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 115598197 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-6-fluoropyridin-2-amine |
| SMILES | CC(Nc1cccc(F)n1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H15FN2O/c1-10(17-15-4-2-3-14(16)18-15)11-5-6-13-12(9-11)7-8-19-13/h2-6,9-10H,7-8H2,1H3,(H,17,18) |
| InChIKey | RYGXHFFLECIOKA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|