C15H14F4N2O — CID 133274740
6-fluoro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-2-amine (PubChem CID 133274740) has the molecular formula C15H14F4N2O and a molecular weight of 314.28 g/mol. Its IUPAC name is 6-fluoro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-2-amine.
| Compound Name | 6-fluoro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133274740 |
| Molecular Formula | C15H14F4N2O |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 6-fluoro-N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]pyridin-2-amine |
| SMILES | CC(Nc1cccc(F)n1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F4N2O/c1-10(20-14-4-2-3-13(16)21-14)11-5-7-12(8-6-11)22-9-15(17,18)19/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | GNYNZEUJCQKTTD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|