C15H14F3N5O — CID 47984131
N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-7H-purin-6-amine (PubChem CID 47984131) has the molecular formula C15H14F3N5O and a molecular weight of 337.31 g/mol. Its IUPAC name is N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 47984131 |
| Molecular Formula | C15H14F3N5O |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3N5O/c1-9(23-14-12-13(20-7-19-12)21-8-22-14)10-2-4-11(5-3-10)24-6-15(16,17)18/h2-5,7-9H,6H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | KXVAZQGELNGOBA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |