C9H13N5O — CID 40514758
N-[(2S)-1-methoxypropan-2-yl]-7H-purin-6-amine (PubChem CID 40514758) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is N-[(2S)-1-methoxypropan-2-yl]-7H-purin-6-amine.
| Compound Name | N-[(2S)-1-methoxypropan-2-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 40514758 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(2S)-1-methoxypropan-2-yl]-7H-purin-6-amine |
| SMILES | COC[C@H](C)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H13N5O/c1-6(3-15-2)14-9-7-8(11-4-10-7)12-5-13-9/h4-6H,3H2,1-2H3,(H2,10,11,12,13,14)/t6-/m0/s1 |
| InChIKey | OKKLXBQHJZAERY-LURJTMIESA-N |
| XLogP | 0.80 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |