C17H21N5O3 — CID 94432733
N-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-7H-purin-6-amine (PubChem CID 94432733) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 94432733 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[(1R)-1-[3-methoxy-4-(2-methoxyethoxy)phenyl]ethyl]-7H-purin-6-amine |
| SMILES | COCCOc1ccc([C@@H](C)Nc2ncnc3nc[nH]c23)cc1OC |
| InChI | InChI=1S/C17H21N5O3/c1-11(22-17-15-16(19-9-18-15)20-10-21-17)12-4-5-13(14(8-12)24-3)25-7-6-23-2/h4-5,8-11H,6-7H2,1-3H3,(H2,18,19,20,21,22)/t11-/m1/s1 |
| InChIKey | JRPYOLJGFXCLQR-LLVKDONJSA-N |
| XLogP | 2.56 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|