C13H13N5O2 — CID 756650
N-(2,5-dimethoxyphenyl)-7H-purin-6-amine (PubChem CID 756650) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-7H-purin-6-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 756650 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-7H-purin-6-amine |
| SMILES | COc1ccc(OC)c(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C13H13N5O2/c1-19-8-3-4-10(20-2)9(5-8)18-13-11-12(15-6-14-11)16-7-17-13/h3-7H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | RLPYPMRNKCEWEK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |