C12H10BrN5 — CID 69241841
N-(2-bromo-4-methylphenyl)-7H-purin-6-amine (PubChem CID 69241841) has the molecular formula C12H10BrN5 and a molecular weight of 304.15 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-7H-purin-6-amine.
| Compound Name | N-(2-bromo-4-methylphenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 69241841 |
| Molecular Formula | C12H10BrN5 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-7H-purin-6-amine |
| SMILES | Cc1ccc(Nc2ncnc3nc[nH]c23)c(Br)c1 |
| InChI | InChI=1S/C12H10BrN5/c1-7-2-3-9(8(13)4-7)18-12-10-11(15-5-14-10)16-6-17-12/h2-6H,1H3,(H2,14,15,16,17,18) |
| InChIKey | AWXXEUBFUCZJQA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |