C18H16N6 — CID 108778162
1-N-(4-methylphenyl)-2-N-(7H-purin-6-yl)benzene-1,2-diamine (PubChem CID 108778162) has the molecular formula C18H16N6 and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-N-(4-methylphenyl)-2-N-(7H-purin-6-yl)benzene-1,2-diamine.
| Compound Name | 1-N-(4-methylphenyl)-2-N-(7H-purin-6-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 108778162 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-N-(4-methylphenyl)-2-N-(7H-purin-6-yl)benzene-1,2-diamine |
| SMILES | Cc1ccc(Nc2ccccc2Nc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C18H16N6/c1-12-6-8-13(9-7-12)23-14-4-2-3-5-15(14)24-18-16-17(20-10-19-16)21-11-22-18/h2-11,23H,1H3,(H2,19,20,21,22,24) |
| InChIKey | WQTFZFLBZXYHOO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |