C15H12N6S — CID 108772051
N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-7H-purin-6-amine (PubChem CID 108772051) has the molecular formula C15H12N6S and a molecular weight of 308.37 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-7H-purin-6-amine.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 108772051 |
| Molecular Formula | C15H12N6S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]-7H-purin-6-amine |
| SMILES | Cc1nc(-c2ccc(Nc3ncnc4nc[nH]c34)cc2)cs1 |
| InChI | InChI=1S/C15H12N6S/c1-9-20-12(6-22-9)10-2-4-11(5-3-10)21-15-13-14(17-7-16-13)18-8-19-15/h2-8H,1H3,(H2,16,17,18,19,21) |
| InChIKey | PKQTZWWKKPSCDQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |