C11H7F2N5 — CID 69242091
N-(3,5-difluorophenyl)-7H-purin-6-amine (PubChem CID 69242091) has the molecular formula C11H7F2N5 and a molecular weight of 247.21 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-7H-purin-6-amine.
| Compound Name | N-(3,5-difluorophenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 69242091 |
| Molecular Formula | C11H7F2N5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-(3,5-difluorophenyl)-7H-purin-6-amine |
| SMILES | Fc1cc(F)cc(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C11H7F2N5/c12-6-1-7(13)3-8(2-6)18-11-9-10(15-4-14-9)16-5-17-11/h1-5H,(H2,14,15,16,17,18) |
| InChIKey | SFYZYUGAQTZJIW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |