C11H6F3N5 — CID 69242349
N-(2,3,4-trifluorophenyl)-7H-purin-6-amine (PubChem CID 69242349) has the molecular formula C11H6F3N5 and a molecular weight of 265.20 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)-7H-purin-6-amine.
| Compound Name | N-(2,3,4-trifluorophenyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 69242349 |
| Molecular Formula | C11H6F3N5 |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)-7H-purin-6-amine |
| SMILES | Fc1ccc(Nc2ncnc3nc[nH]c23)c(F)c1F |
| InChI | InChI=1S/C11H6F3N5/c12-5-1-2-6(8(14)7(5)13)19-11-9-10(16-3-15-9)17-4-18-11/h1-4H,(H2,15,16,17,18,19) |
| InChIKey | QGJNROFJAPEBPJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|