C12H9F2N5 — CID 69240317
N-[(2,6-difluorophenyl)methyl]-7H-purin-6-amine (PubChem CID 69240317) has the molecular formula C12H9F2N5 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 69240317 |
| Molecular Formula | C12H9F2N5 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-7H-purin-6-amine |
| SMILES | Fc1cccc(F)c1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H9F2N5/c13-8-2-1-3-9(14)7(8)4-15-11-10-12(17-5-16-10)19-6-18-11/h1-3,5-6H,4H2,(H2,15,16,17,18,19) |
| InChIKey | UULDOANBEOTFRX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |