C11H9FN6 — CID 171679663
N-[(3-fluoro-4-pyridinyl)methyl]-7H-purin-6-amine (PubChem CID 171679663) has the molecular formula C11H9FN6 and a molecular weight of 244.23 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridinyl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(3-fluoro-4-pyridinyl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 171679663 |
| Molecular Formula | C11H9FN6 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | N-[(3-fluoro-4-pyridinyl)methyl]-7H-purin-6-amine |
| SMILES | Fc1cnccc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H9FN6/c12-8-4-13-2-1-7(8)3-14-10-9-11(16-5-15-9)18-6-17-10/h1-2,4-6H,3H2,(H2,14,15,16,17,18) |
| InChIKey | BOJWXKYGWFISKW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |