C19H15FN8 — CID 141225548
N-[[8-fluoro-2-(3-methylimidazol-4-yl)quinolin-3-yl]methyl]-7H-purin-6-amine (PubChem CID 141225548) has the molecular formula C19H15FN8 and a molecular weight of 374.38 g/mol. Its IUPAC name is N-[[8-fluoro-2-(3-methylimidazol-4-yl)quinolin-3-yl]methyl]-7H-purin-6-amine.
| Compound Name | N-[[8-fluoro-2-(3-methylimidazol-4-yl)quinolin-3-yl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 141225548 |
| Molecular Formula | C19H15FN8 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[[8-fluoro-2-(3-methylimidazol-4-yl)quinolin-3-yl]methyl]-7H-purin-6-amine |
| SMILES | Cn1cncc1-c1nc2c(F)cccc2cc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C19H15FN8/c1-28-10-21-7-14(28)16-12(5-11-3-2-4-13(20)15(11)27-16)6-22-18-17-19(24-8-23-17)26-9-25-18/h2-5,7-10H,6H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | BZZYZPXINWJQJG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |