C22H16ClFN6 — CID 69046602
N-[2-[8-chloro-2-(2-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 69046602) has the molecular formula C22H16ClFN6 and a molecular weight of 418.86 g/mol. Its IUPAC name is N-[2-[8-chloro-2-(2-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-[8-chloro-2-(2-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 69046602 |
| Molecular Formula | C22H16ClFN6 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[2-[8-chloro-2-(2-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | Fc1ccccc1-c1nc2c(Cl)cccc2cc1CCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C22H16ClFN6/c23-16-6-3-4-13-10-14(18(30-19(13)16)15-5-1-2-7-17(15)24)8-9-25-21-20-22(27-11-26-20)29-12-28-21/h1-7,10-12H,8-9H2,(H2,25,26,27,28,29) |
| InChIKey | NZFYOWZECCGKAZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |