C19H14ClN7S — CID 69043949
N-[2-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 69043949) has the molecular formula C19H14ClN7S and a molecular weight of 407.89 g/mol. Its IUPAC name is N-[2-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 69043949 |
| Molecular Formula | C19H14ClN7S |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[2-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | Clc1cccc2cc(CCNc3ncnc4nc[nH]c34)c(-c3cscn3)nc12 |
| InChI | InChI=1S/C19H14ClN7S/c20-13-3-1-2-11-6-12(16(27-15(11)13)14-7-28-10-26-14)4-5-21-18-17-19(23-8-22-17)25-9-24-18/h1-3,6-10H,4-5H2,(H2,21,22,23,24,25) |
| InChIKey | JSCNXSATJQILNV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |