C18H16ClN7O2 — CID 66821996
2-[[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]quinolin-2-yl]amino]acetic acid (PubChem CID 66821996) has the molecular formula C18H16ClN7O2 and a molecular weight of 397.83 g/mol. Its IUPAC name is 2-[[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]quinolin-2-yl]amino]acetic acid.
| Compound Name | 2-[[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]quinolin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 66821996 |
| Molecular Formula | C18H16ClN7O2 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[[8-chloro-3-[1-(7H-purin-6-ylamino)ethyl]quinolin-2-yl]amino]acetic acid |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2nc1NCC(=O)O |
| InChI | InChI=1S/C18H16ClN7O2/c1-9(25-18-15-17(22-7-21-15)23-8-24-18)11-5-10-3-2-4-12(19)14(10)26-16(11)20-6-13(27)28/h2-5,7-9H,6H2,1H3,(H,20,26)(H,27,28)(H2,21,22,23,24,25) |
| InChIKey | QVLNEDCCTRZZQF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |