C22H15ClF2N6 — CID 76599383
N-[1-[2-(3-chloro-5-fluorophenyl)-8-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 76599383) has the molecular formula C22H15ClF2N6 and a molecular weight of 436.85 g/mol. Its IUPAC name is N-[1-[2-(3-chloro-5-fluorophenyl)-8-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[2-(3-chloro-5-fluorophenyl)-8-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 76599383 |
| Molecular Formula | C22H15ClF2N6 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-[1-[2-(3-chloro-5-fluorophenyl)-8-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(F)c2nc1-c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C22H15ClF2N6/c1-11(30-22-20-21(27-9-26-20)28-10-29-22)16-7-12-3-2-4-17(25)19(12)31-18(16)13-5-14(23)8-15(24)6-13/h2-11H,1H3,(H2,26,27,28,29,30) |
| InChIKey | VDYILWKQLNPTLY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |