C22H16F2N6 — CID 67511145
N-[1-[6-fluoro-4-(3-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 67511145) has the molecular formula C22H16F2N6 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[1-[6-fluoro-4-(3-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[6-fluoro-4-(3-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 67511145 |
| Molecular Formula | C22H16F2N6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[1-[6-fluoro-4-(3-fluorophenyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cnc2ccc(F)cc2c1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H16F2N6/c1-12(30-22-20-21(27-10-26-20)28-11-29-22)17-9-25-18-6-5-15(24)8-16(18)19(17)13-3-2-4-14(23)7-13/h2-12H,1H3,(H2,26,27,28,29,30) |
| InChIKey | CUXTVROZAVEPSP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |