C20H21FN6 — CID 56599717
N-[(1S)-1-(2-butyl-7-fluoroquinolin-3-yl)ethyl]-7H-purin-6-amine (PubChem CID 56599717) has the molecular formula C20H21FN6 and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[(1S)-1-(2-butyl-7-fluoroquinolin-3-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-(2-butyl-7-fluoroquinolin-3-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 56599717 |
| Molecular Formula | C20H21FN6 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[(1S)-1-(2-butyl-7-fluoroquinolin-3-yl)ethyl]-7H-purin-6-amine |
| SMILES | CCCCc1nc2cc(F)ccc2cc1[C@H](C)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C20H21FN6/c1-3-4-5-16-15(8-13-6-7-14(21)9-17(13)27-16)12(2)26-20-18-19(23-10-22-18)24-11-25-20/h6-12H,3-5H2,1-2H3,(H2,22,23,24,25,26)/t12-/m0/s1 |
| InChIKey | SNOUYVZSEJXORG-LBPRGKRZSA-N |
| XLogP | 4.56 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |