C20H22FN7 — CID 66632635
N-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 66632635) has the molecular formula C20H22FN7 and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 66632635 |
| Molecular Formula | C20H22FN7 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-fluoroquinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | CCN(C)Cc1nc2cc(F)ccc2cc1[C@H](C)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C20H22FN7/c1-4-28(3)9-17-15(7-13-5-6-14(21)8-16(13)27-17)12(2)26-20-18-19(23-10-22-18)24-11-25-20/h5-8,10-12H,4,9H2,1-3H3,(H2,22,23,24,25,26)/t12-/m0/s1 |
| InChIKey | MPDLLYTWCVWXIU-LBPRGKRZSA-N |
| XLogP | 3.66 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |