C21H20F4N6 — CID 66632769
N-[1-[7-fluoro-2-(5,5,5-trifluoropentyl)quinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 66632769) has the molecular formula C21H20F4N6 and a molecular weight of 432.43 g/mol. Its IUPAC name is N-[1-[7-fluoro-2-(5,5,5-trifluoropentyl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[7-fluoro-2-(5,5,5-trifluoropentyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 66632769 |
| Molecular Formula | C21H20F4N6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[1-[7-fluoro-2-(5,5,5-trifluoropentyl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2ccc(F)cc2nc1CCCCC(F)(F)F |
| InChI | InChI=1S/C21H20F4N6/c1-12(30-20-18-19(27-10-26-18)28-11-29-20)15-8-13-5-6-14(22)9-17(13)31-16(15)4-2-3-7-21(23,24)25/h5-6,8-12H,2-4,7H2,1H3,(H2,26,27,28,29,30) |
| InChIKey | NXFRSMPIFSWGJE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|