C21H16FN7 — CID 67511498
N-[1-(6-fluoro-4-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine (PubChem CID 67511498) has the molecular formula C21H16FN7 and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[1-(6-fluoro-4-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-(6-fluoro-4-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 67511498 |
| Molecular Formula | C21H16FN7 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-[1-(6-fluoro-4-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cnc2ccc(F)cc2c1-c1ccccn1 |
| InChI | InChI=1S/C21H16FN7/c1-12(29-21-19-20(26-10-25-19)27-11-28-21)15-9-24-16-6-5-13(22)8-14(16)18(15)17-4-2-3-7-23-17/h2-12H,1H3,(H2,25,26,27,28,29) |
| InChIKey | BDOXCEFKKWXKFH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |