C22H15F2N5O2 — CID 53235314
6-fluoro-3-(3-fluorophenyl)-2-[(1R)-1-(7H-purin-6-ylamino)ethyl]chromen-4-one (PubChem CID 53235314) has the molecular formula C22H15F2N5O2 and a molecular weight of 419.39 g/mol. Its IUPAC name is 6-fluoro-3-(3-fluorophenyl)-2-[(1R)-1-(7H-purin-6-ylamino)ethyl]chromen-4-one.
| Compound Name | 6-fluoro-3-(3-fluorophenyl)-2-[(1R)-1-(7H-purin-6-ylamino)ethyl]chromen-4-one |
|---|---|
| PubChem CID | 53235314 |
| Molecular Formula | C22H15F2N5O2 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 6-fluoro-3-(3-fluorophenyl)-2-[(1R)-1-(7H-purin-6-ylamino)ethyl]chromen-4-one |
| SMILES | C[C@@H](Nc1ncnc2nc[nH]c12)c1oc2ccc(F)cc2c(=O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H15F2N5O2/c1-11(29-22-18-21(26-9-25-18)27-10-28-22)20-17(12-3-2-4-13(23)7-12)19(30)15-8-14(24)5-6-16(15)31-20/h2-11H,1H3,(H2,25,26,27,28,29)/t11-/m1/s1 |
| InChIKey | ZXRCPILJODBCHJ-LLVKDONJSA-N |
| XLogP | 4.58 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |