C22H16FN5O2 — CID 66579107
3-(3-fluorophenyl)-2-[2-(7H-purin-6-ylamino)ethyl]chromen-4-one (PubChem CID 66579107) has the molecular formula C22H16FN5O2 and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2-[2-(7H-purin-6-ylamino)ethyl]chromen-4-one.
| Compound Name | 3-(3-fluorophenyl)-2-[2-(7H-purin-6-ylamino)ethyl]chromen-4-one |
|---|---|
| PubChem CID | 66579107 |
| Molecular Formula | C22H16FN5O2 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-(3-fluorophenyl)-2-[2-(7H-purin-6-ylamino)ethyl]chromen-4-one |
| SMILES | O=c1c(-c2cccc(F)c2)c(CCNc2ncnc3nc[nH]c23)oc2ccccc12 |
| InChI | InChI=1S/C22H16FN5O2/c23-14-5-3-4-13(10-14)18-17(30-16-7-2-1-6-15(16)20(18)29)8-9-24-21-19-22(26-11-25-19)28-12-27-21/h1-7,10-12H,8-9H2,(H2,24,25,26,27,28) |
| InChIKey | XOGSZJNOCJJSGS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |