C21H15N5O2 — CID 118131042
4-phenyl-3-[(7H-purin-6-ylamino)methyl]isochromen-1-one (PubChem CID 118131042) has the molecular formula C21H15N5O2 and a molecular weight of 369.38 g/mol. Its IUPAC name is 4-phenyl-3-[(7H-purin-6-ylamino)methyl]isochromen-1-one.
| Compound Name | 4-phenyl-3-[(7H-purin-6-ylamino)methyl]isochromen-1-one |
|---|---|
| PubChem CID | 118131042 |
| Molecular Formula | C21H15N5O2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-phenyl-3-[(7H-purin-6-ylamino)methyl]isochromen-1-one |
| SMILES | O=c1oc(CNc2ncnc3nc[nH]c23)c(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C21H15N5O2/c27-21-15-9-5-4-8-14(15)17(13-6-2-1-3-7-13)16(28-21)10-22-19-18-20(24-11-23-18)26-12-25-19/h1-9,11-12H,10H2,(H2,22,23,24,25,26) |
| InChIKey | CVXJPTOTAVVZQH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |