C11H13N7O2 — CID 68661345
N-(furan-2-ylmethyl)-7H-purin-6-amine;urea (PubChem CID 68661345) has the molecular formula C11H13N7O2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-7H-purin-6-amine;urea.
| Compound Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;urea |
|---|---|
| PubChem CID | 68661345 |
| Molecular Formula | C11H13N7O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;urea |
| SMILES | NC(N)=O.c1coc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C10H9N5O.CH4N2O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9;2-1(3)4/h1-3,5-6H,4H2,(H2,11,12,13,14,15);(H4,2,3,4) |
| InChIKey | QKWYYTOOTMHZMH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |