C18H15Cl2N5O4 — CID 67759594
2-(2,4-dichlorophenoxy)acetic acid;N-(furan-2-ylmethyl)-7H-purin-6-amine (PubChem CID 67759594) has the molecular formula C18H15Cl2N5O4 and a molecular weight of 436.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)acetic acid;N-(furan-2-ylmethyl)-7H-purin-6-amine.
| Compound Name | 2-(2,4-dichlorophenoxy)acetic acid;N-(furan-2-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 67759594 |
| Molecular Formula | C18H15Cl2N5O4 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)acetic acid;N-(furan-2-ylmethyl)-7H-purin-6-amine |
| SMILES | O=C(O)COc1ccc(Cl)cc1Cl.c1coc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C10H9N5O.C8H6Cl2O3/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9;9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3,5-6H,4H2,(H2,11,12,13,14,15);1-3H,4H2,(H,11,12) |
| InChIKey | QRQHVFKCTBMOIL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |