C8H6Cl2NaO3+ — CID 91996937
sodium 2-(2,4-dichlorophenoxy)acetic acid (PubChem CID 91996937) has the molecular formula C8H6Cl2NaO3+ and a molecular weight of 244.03 g/mol. Its IUPAC name is sodium 2-(2,4-dichlorophenoxy)acetic acid.
| Compound Name | sodium 2-(2,4-dichlorophenoxy)acetic acid |
|---|---|
| PubChem CID | 91996937 |
| Molecular Formula | C8H6Cl2NaO3+ |
| Molecular Weight | 244.03 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | sodium 2-(2,4-dichlorophenoxy)acetic acid |
| SMILES | O=C(O)COc1ccc(Cl)cc1Cl.[Na+] |
| InChI | InChI=1S/C8H6Cl2O3.Na/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1 |
| InChIKey | RFOHRSIAXQACDB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.03 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |