C8H6Cl2O3 — CID 138395985
deuterio 2-(2,4-dichlorophenoxy)acetate (PubChem CID 138395985) has the molecular formula C8H6Cl2O3 and a molecular weight of 222.05 g/mol. Its IUPAC name is deuterio 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | deuterio 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 138395985 |
| Molecular Formula | C8H6Cl2O3 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | deuterio 2-(2,4-dichlorophenoxy)acetate |
| SMILES | [2H]OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12)/i/hD |
| InChIKey | OVSKIKFHRZPJSS-DYCDLGHISA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |