C8H6Cl2KNO3 — CID 23697377
potassium 2-(2,4-dichlorophenoxy)-N-oxidoacetamide (PubChem CID 23697377) has the molecular formula C8H6Cl2KNO3 and a molecular weight of 274.14 g/mol. Its IUPAC name is potassium 2-(2,4-dichlorophenoxy)-N-oxidoacetamide.
| Compound Name | potassium 2-(2,4-dichlorophenoxy)-N-oxidoacetamide |
|---|---|
| PubChem CID | 23697377 |
| Molecular Formula | C8H6Cl2KNO3 |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 272.94 |
| IUPAC Name | potassium 2-(2,4-dichlorophenoxy)-N-oxidoacetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N[O-].[K+] |
| InChI | InChI=1S/C8H6Cl2NO3.K/c9-5-1-2-7(6(10)3-5)14-4-8(12)11-13;/h1-3H,4H2,(H-,11,12,13);/q-1;+1 |
| InChIKey | VMVDUTINCTXLFF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|