C14H11Cl2NO3 — CID 976414
2-(2,4-dichlorophenoxy)-N-(4-hydroxyphenyl)acetamide (PubChem CID 976414) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 976414 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C14H11Cl2NO3/c15-9-1-6-13(12(16)7-9)20-8-14(19)17-10-2-4-11(18)5-3-10/h1-7,18H,8H2,(H,17,19) |
| InChIKey | ZWKXYBQENNIOQY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|