C14H14Cl2N2O2 — CID 12620177
2-(2,4-dichlorophenoxy)-N-(2,5-dimethylpyrrol-1-yl)acetamide (PubChem CID 12620177) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2,5-dimethylpyrrol-1-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2,5-dimethylpyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 12620177 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2,5-dimethylpyrrol-1-yl)acetamide |
| SMILES | Cc1ccc(C)n1NC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9-3-4-10(2)18(9)17-14(19)8-20-13-6-5-11(15)7-12(13)16/h3-7H,8H2,1-2H3,(H,17,19) |
| InChIKey | ALLMJXAIPUJAJD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |