C18H15Cl5O6 — CID 70569666
4-(2,4-dichlorophenoxy)butanoic acid;2-(2,4,5-trichlorophenoxy)acetic acid (PubChem CID 70569666) has the molecular formula C18H15Cl5O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)butanoic acid;2-(2,4,5-trichlorophenoxy)acetic acid.
| Compound Name | 4-(2,4-dichlorophenoxy)butanoic acid;2-(2,4,5-trichlorophenoxy)acetic acid |
|---|---|
| PubChem CID | 70569666 |
| Molecular Formula | C18H15Cl5O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 501.93 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)butanoic acid;2-(2,4,5-trichlorophenoxy)acetic acid |
| SMILES | O=C(O)CCCOc1ccc(Cl)cc1Cl.O=C(O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2O3.C8H5Cl3O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h3-4,6H,1-2,5H2,(H,13,14);1-2H,3H2,(H,12,13) |
| InChIKey | XDMKGAZCPHTPIS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|