C25H30Cl4O6 — CID 67858556
2-(2,4-dichlorophenoxy)acetic acid;6-methylheptyl 3-(2,4-dichlorophenoxy)propanoate (PubChem CID 67858556) has the molecular formula C25H30Cl4O6 and a molecular weight of 568.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)acetic acid;6-methylheptyl 3-(2,4-dichlorophenoxy)propanoate.
| Compound Name | 2-(2,4-dichlorophenoxy)acetic acid;6-methylheptyl 3-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 67858556 |
| Molecular Formula | C25H30Cl4O6 |
| Molecular Weight | 568.32 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)acetic acid;6-methylheptyl 3-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(C)CCCCCOC(=O)CCOc1ccc(Cl)cc1Cl.O=C(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H24Cl2O3.C8H6Cl2O3/c1-13(2)6-4-3-5-10-22-17(20)9-11-21-16-8-7-14(18)12-15(16)19;9-5-1-2-7(6(10)3-5)13-4-8(11)12/h7-8,12-13H,3-6,9-11H2,1-2H3;1-3H,4H2,(H,11,12) |
| InChIKey | JAWNCNDAFCVRET-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.32 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|