C19H19Cl3O6 — CID 67853868
4-(4-chloro-2-methylphenoxy)butanoic acid;2-(2,4-dichlorophenoxy)acetic acid (PubChem CID 67853868) has the molecular formula C19H19Cl3O6 and a molecular weight of 449.71 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)butanoic acid;2-(2,4-dichlorophenoxy)acetic acid.
| Compound Name | 4-(4-chloro-2-methylphenoxy)butanoic acid;2-(2,4-dichlorophenoxy)acetic acid |
|---|---|
| PubChem CID | 67853868 |
| Molecular Formula | C19H19Cl3O6 |
| Molecular Weight | 449.71 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)butanoic acid;2-(2,4-dichlorophenoxy)acetic acid |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)O.O=C(O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13ClO3.C8H6Cl2O3/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14;9-5-1-2-7(6(10)3-5)13-4-8(11)12/h4-5,7H,2-3,6H2,1H3,(H,13,14);1-3H,4H2,(H,11,12) |
| InChIKey | ZXWTUSLVJWXKOK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|