C18H18Cl2O5S — CID 22504785
2-[4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methoxy-2-methylphenoxy]acetic acid (PubChem CID 22504785) has the molecular formula C18H18Cl2O5S and a molecular weight of 417.31 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methoxy-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methoxy-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 22504785 |
| Molecular Formula | C18H18Cl2O5S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methoxy-2-methylphenoxy]acetic acid |
| SMILES | COc1cc(OCC(=O)O)c(C)cc1SCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2O5S/c1-11-7-17(16(23-2)9-15(11)25-10-18(21)22)26-6-5-24-14-4-3-12(19)8-13(14)20/h3-4,7-9H,5-6,10H2,1-2H3,(H,21,22) |
| InChIKey | FNYPIYRNPIUDGY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|