C17H15Cl3O4S — CID 22504737
2-[2-methyl-4-[2-(2,4,5-trichlorophenoxy)ethylsulfanyl]phenoxy]acetic acid (PubChem CID 22504737) has the molecular formula C17H15Cl3O4S and a molecular weight of 421.73 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-(2,4,5-trichlorophenoxy)ethylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[2-(2,4,5-trichlorophenoxy)ethylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 22504737 |
| Molecular Formula | C17H15Cl3O4S |
| Molecular Weight | 421.73 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 2-[2-methyl-4-[2-(2,4,5-trichlorophenoxy)ethylsulfanyl]phenoxy]acetic acid |
| SMILES | Cc1cc(SCCOc2cc(Cl)c(Cl)cc2Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C17H15Cl3O4S/c1-10-6-11(2-3-15(10)24-9-17(21)22)25-5-4-23-16-8-13(19)12(18)7-14(16)20/h2-3,6-8H,4-5,9H2,1H3,(H,21,22) |
| InChIKey | LCOITYTXAJPDMB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|