C26H27NO4S — CID 87833830
2-[2-methyl-4-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethylsulfanyl]phenoxy]acetic acid (PubChem CID 87833830) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 87833830 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-[2-methyl-4-[2-[(E)-1-(4-phenylphenyl)propylideneamino]oxyethylsulfanyl]phenoxy]acetic acid |
| SMILES | CC/C(=N\OCCSc1ccc(OCC(=O)O)c(C)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO4S/c1-3-24(22-11-9-21(10-12-22)20-7-5-4-6-8-20)27-31-15-16-32-23-13-14-25(19(2)17-23)30-18-26(28)29/h4-14,17H,3,15-16,18H2,1-2H3,(H,28,29)/b27-24+ |
| InChIKey | YAMGNCXLXQOEIE-SOYKGTTHSA-N |
| XLogP | 6.05 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|