About 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid
2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid (PubChem CID 10257598) has the molecular formula C36H28F2O3S
and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid |
| PubChem CID | 10257598 |
| Molecular Formula | C36H28F2O3S |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(SCC=C(c2ccc(-c3cccc(F)c3)cc2)c2ccc(-c3cccc(F)c3)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C36H28F2O3S/c1-24-20-33(16-17-35(24)41-23-36(39)40)42-19-18-34(27-12-8-25(9-13-27)29-4-2-6-31(37)21-29)28-14-10-26(11-15-28)30-5-3-7-32(38)22-30/h2-18,20-22H,19,23H2,1H3,(H,39,40) |
| InChIKey | SIVIFLATVSDYMY-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid?
The IUPAC name of 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid (CID 10257598) is 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid.
What is the SMILES notation for 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid?
The canonical SMILES for 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid is Cc1cc(SCC=C(c2ccc(-c3cccc(F)c3)cc2)c2ccc(-c3cccc(F)c3)cc2)ccc1OCC(=O)O.
What is the InChIKey of 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid?
The InChIKey is SIVIFLATVSDYMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H28F2O3S/c1-24-20-33(16-17-35(24)41-23-36(39)40)42-19-18-34(27-12-8-25(9-13-27)29-4-2-6-31(37)21-29)28-14-10-26(11-15-28)30-5-3-7-32(38)22-30/h2-18,20-22H,19,23H2,1H3,(H,39,40).
What are the key properties of 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid?
2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid has a molecular weight of 578.68 g/mol, XLogP of 9.29, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3,3-bis[4-(3-fluorophenyl)phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetic acid is sourced from PubChem (CID 10257598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).