C33H28O4S — CID 11692128
2-[4-[(Z)-5-(4-methoxyphenyl)-3-(4-phenylphenyl)pent-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid (PubChem CID 11692128) has the molecular formula C33H28O4S and a molecular weight of 520.65 g/mol. Its IUPAC name is 2-[4-[(Z)-5-(4-methoxyphenyl)-3-(4-phenylphenyl)pent-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-5-(4-methoxyphenyl)-3-(4-phenylphenyl)pent-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11692128 |
| Molecular Formula | C33H28O4S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-[4-[(Z)-5-(4-methoxyphenyl)-3-(4-phenylphenyl)pent-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid |
| SMILES | COc1ccc(C#C/C(=C\CSc2ccc(OCC(=O)O)c(C)c2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H28O4S/c1-24-22-31(18-19-32(24)37-23-33(34)35)38-21-20-29(11-8-25-9-16-30(36-2)17-10-25)28-14-12-27(13-15-28)26-6-4-3-5-7-26/h3-7,9-10,12-20,22H,21,23H2,1-2H3,(H,34,35)/b29-20+ |
| InChIKey | UYCASQYDNKYYNI-ZTKZIYFRSA-N |
| XLogP | 7.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|